![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 15 - Farewell Fire.flac | 2024-10-08 00:24 | 254M | |
| 03 - Satellite Anthem Icarus.flac | 2024-10-08 00:25 | 213M | |
| 13 - Slow This Bird Down.flac | 2024-10-08 00:24 | 211M | |
| 02 - Chromakey Dreamcoat.flac | 2024-10-08 00:23 | 209M | |
| 04 - Peacock Tail.flac | 2024-10-08 00:24 | 187M | |
| 09 - Oscar See Through Red Eye.flac | 2024-10-08 00:24 | 181M | |
| 05 - Dayvan Cowboy.flac | 2024-10-08 00:24 | 180M | |
| 11 - Hey Saturday Sun.flac | 2024-10-08 00:25 | 169M | |
| 07 - '84 Pontiac Dream.flac | 2024-10-08 00:24 | 135M | |
| 14 - Tears from the Compound Eye.flac | 2024-10-08 00:21 | 131M | |
| 08 - Sherbet Head.flac | 2024-10-08 00:25 | 91M | |
| 12 - Constants Are Changing.flac | 2024-10-08 00:21 | 54M | |
| 10 - Ataronchronon.flac | 2024-10-08 00:20 | 39M | |
| 06 - A Moment of Clarity.flac | 2024-10-08 00:23 | 27M | |
| 01 - Into the Rainbow Vein.flac | 2024-10-08 00:17 | 24M | |
| folder.jpg | 2024-10-07 16:10 | 56K | |
| foo_dr.txt | 2024-10-07 16:10 | 1.7K | |
| lineage.txt | 2024-10-07 16:10 | 550 | |
| Boards of Canada - The Campfire Headphase.m3u | 2024-10-07 16:10 | 451 | |
| Artwork/ | 2024-10-08 18:00 | - | |